C18H20N6O2 — CID 136633950
2-[(3R)-3-aminopiperidin-1-yl]-5-phenacyl-1H-imidazo[4,5-d]pyridazin-4-one (PubChem CID 136633950) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 2-[(3R)-3-aminopiperidin-1-yl]-5-phenacyl-1H-imidazo[4,5-d]pyridazin-4-one.
| Compound Name | 2-[(3R)-3-aminopiperidin-1-yl]-5-phenacyl-1H-imidazo[4,5-d]pyridazin-4-one |
|---|---|
| PubChem CID | 136633950 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-[(3R)-3-aminopiperidin-1-yl]-5-phenacyl-1H-imidazo[4,5-d]pyridazin-4-one |
| SMILES | N[C@@H]1CCCN(c2nc3c(=O)n(CC(=O)c4ccccc4)ncc3[nH]2)C1 |
| InChI | InChI=1S/C18H20N6O2/c19-13-7-4-8-23(10-13)18-21-14-9-20-24(17(26)16(14)22-18)11-15(25)12-5-2-1-3-6-12/h1-3,5-6,9,13H,4,7-8,10-11,19H2,(H,21,22)/t13-/m1/s1 |
| InChIKey | KXKDSYYSUVWGNS-CYBMUJFWSA-N |
| XLogP | 0.93 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |