C28H33F2N5O3 — CID 136634278
2-[4-[7-(difluoromethyl)-5-(3,4-dimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]phenyl]-1-(2-methylpiperazin-1-yl)ethanone (PubChem CID 136634278) has the molecular formula C28H33F2N5O3 and a molecular weight of 525.60 g/mol. Its IUPAC name is 2-[4-[7-(difluoromethyl)-5-(3,4-dimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]phenyl]-1-(2-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-[4-[7-(difluoromethyl)-5-(3,4-dimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]phenyl]-1-(2-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 136634278 |
| Molecular Formula | C28H33F2N5O3 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | 2-[4-[7-(difluoromethyl)-5-(3,4-dimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]phenyl]-1-(2-methylpiperazin-1-yl)ethanone |
| SMILES | COc1ccc(C2CC(C(F)F)n3nc(-c4ccc(CC(=O)N5CCNCC5C)cc4)cc3N2)cc1OC |
| InChI | InChI=1S/C28H33F2N5O3/c1-17-16-31-10-11-34(17)27(36)12-18-4-6-19(7-5-18)22-15-26-32-21(14-23(28(29)30)35(26)33-22)20-8-9-24(37-2)25(13-20)38-3/h4-9,13,15,17,21,23,28,31-32H,10-12,14,16H2,1-3H3 |
| InChIKey | KTBPKMYBVSRGGP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |