C7H9N3 — CID 136634634
1,6,7,8-tetrahydropyrazolo[5,4-b]azepine (PubChem CID 136634634) has the molecular formula C7H9N3 and a molecular weight of 135.17 g/mol. Its IUPAC name is 1,6,7,8-tetrahydropyrazolo[5,4-b]azepine.
| Compound Name | 1,6,7,8-tetrahydropyrazolo[5,4-b]azepine |
|---|---|
| PubChem CID | 136634634 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 1,6,7,8-tetrahydropyrazolo[5,4-b]azepine |
| SMILES | C1=Cc2cn[nH]c2NCC1 |
| InChI | InChI=1S/C7H9N3/c1-2-4-8-7-6(3-1)5-9-10-7/h1,3,5H,2,4H2,(H2,8,9,10) |
| InChIKey | WLGITPZXYKCXNA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |