About (Z)-3-[[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]amino]prop-2-enimidamide
(Z)-3-[[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]amino]prop-2-enimidamide (PubChem CID 136634784) has the molecular formula C7H13N3O2S
and a molecular weight of 203.27 g/mol. Its IUPAC name is (Z)-3-[[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]amino]prop-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-3-[[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]amino]prop-2-enimidamide |
| PubChem CID | 136634784 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | (Z)-3-[[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]amino]prop-2-enimidamide |
| SMILES | [H]/N=C(N)/C=C\N[C@H]1CS[C@@H](CO)O1 |
| InChI | InChI=1S/C7H13N3O2S/c8-5(9)1-2-10-6-4-13-7(3-11)12-6/h1-2,6-7,10-11H,3-4H2,(H3,8,9)/b2-1-/t6-,7+/m1/s1 |
| InChIKey | OCTHTWBPPKKAPX-WJTODNIASA-N |
| XLogP | -0.57 |
| TPSA | 91.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-[[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]amino]prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-[[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]amino]prop-2-enimidamide?
The IUPAC name of (Z)-3-[[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]amino]prop-2-enimidamide (CID 136634784) is (Z)-3-[[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]amino]prop-2-enimidamide.
What is the SMILES notation for (Z)-3-[[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]amino]prop-2-enimidamide?
The canonical SMILES for (Z)-3-[[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]amino]prop-2-enimidamide is [H]/N=C(N)/C=C\N[C@H]1CS[C@@H](CO)O1.
What is the InChIKey of (Z)-3-[[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]amino]prop-2-enimidamide?
The InChIKey is OCTHTWBPPKKAPX-WJTODNIASA-N. The full InChI is InChI=1S/C7H13N3O2S/c8-5(9)1-2-10-6-4-13-7(3-11)12-6/h1-2,6-7,10-11H,3-4H2,(H3,8,9)/b2-1-/t6-,7+/m1/s1.
What are the key properties of (Z)-3-[[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]amino]prop-2-enimidamide?
(Z)-3-[[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]amino]prop-2-enimidamide has a molecular weight of 203.27 g/mol, XLogP of -0.57, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-[[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]amino]prop-2-enimidamide is sourced from PubChem (CID 136634784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).