C27H33N5O — CID 136634847
4-[(3S)-3-[[(1R,2R)-2-[(5-phenyl-1,2-oxazolidin-3-ylidene)amino]cyclohexyl]amino]piperidin-1-yl]benzonitrile (PubChem CID 136634847) has the molecular formula C27H33N5O and a molecular weight of 443.60 g/mol. Its IUPAC name is 4-[(3S)-3-[[(1R,2R)-2-[(5-phenyl-1,2-oxazolidin-3-ylidene)amino]cyclohexyl]amino]piperidin-1-yl]benzonitrile.
| Compound Name | 4-[(3S)-3-[[(1R,2R)-2-[(5-phenyl-1,2-oxazolidin-3-ylidene)amino]cyclohexyl]amino]piperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 136634847 |
| Molecular Formula | C27H33N5O |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 4-[(3S)-3-[[(1R,2R)-2-[(5-phenyl-1,2-oxazolidin-3-ylidene)amino]cyclohexyl]amino]piperidin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCC[C@H](N[C@@H]3CCCC[C@H]3/N=C3/CC(c4ccccc4)ON3)C2)cc1 |
| InChI | InChI=1S/C27H33N5O/c28-18-20-12-14-23(15-13-20)32-16-6-9-22(19-32)29-24-10-4-5-11-25(24)30-27-17-26(33-31-27)21-7-2-1-3-8-21/h1-3,7-8,12-15,22,24-26,29H,4-6,9-11,16-17,19H2,(H,30,31)/t22-,24+,25+,26?/m0/s1 |
| InChIKey | INLKBAJDRQYCMG-IXNNWERGSA-N |
| XLogP | 4.49 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|