C20H19N3O2 — CID 136635150
1'-methylspiro[naphtho[3,2-e]benzimidazole-2,4'-piperidine]-6,11-diol (PubChem CID 136635150) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 1'-methylspiro[naphtho[3,2-e]benzimidazole-2,4'-piperidine]-6,11-diol.
| Compound Name | 1'-methylspiro[naphtho[3,2-e]benzimidazole-2,4'-piperidine]-6,11-diol |
|---|---|
| PubChem CID | 136635150 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 1'-methylspiro[naphtho[3,2-e]benzimidazole-2,4'-piperidine]-6,11-diol |
| SMILES | CN1CCC2(CC1)N=c1ccc3c(O)c4ccccc4c(O)c3c1=N2 |
| InChI | InChI=1S/C20H19N3O2/c1-23-10-8-20(9-11-23)21-15-7-6-14-16(17(15)22-20)19(25)13-5-3-2-4-12(13)18(14)24/h2-7,24-25H,8-11H2,1H3 |
| InChIKey | BKHMVZZZRCMVCG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 68.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|