C22H27ClN2O6S — CID 136636063
[(3S,4R)-6-(diethylsulfamoyl)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl] 4-chloro-2-hydroxybenzenecarboximidate (PubChem CID 136636063) has the molecular formula C22H27ClN2O6S and a molecular weight of 482.99 g/mol. Its IUPAC name is [(3S,4R)-6-(diethylsulfamoyl)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl] 4-chloro-2-hydroxybenzenecarboximidate.
| Compound Name | [(3S,4R)-6-(diethylsulfamoyl)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl] 4-chloro-2-hydroxybenzenecarboximidate |
|---|---|
| PubChem CID | 136636063 |
| Molecular Formula | C22H27ClN2O6S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | [(3S,4R)-6-(diethylsulfamoyl)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl] 4-chloro-2-hydroxybenzenecarboximidate |
| SMILES | [H]/N=C(/O[C@@H]1c2cc(S(=O)(=O)N(CC)CC)ccc2OC(C)(C)[C@H]1O)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C22H27ClN2O6S/c1-5-25(6-2)32(28,29)14-8-10-18-16(12-14)19(20(27)22(3,4)31-18)30-21(24)15-9-7-13(23)11-17(15)26/h7-12,19-20,24,26-27H,5-6H2,1-4H3/b24-21+/t19-,20+/m1/s1 |
| InChIKey | UTAKGVYRMOKJRV-INFINQIGSA-N |
| XLogP | 3.69 |
| TPSA | 120.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|