C24H29F2N3O3S — CID 136636217
N-[[4-[[[(3aR,9bS)-7,8-difluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]furan-2-sulfonamide (PubChem CID 136636217) has the molecular formula C24H29F2N3O3S and a molecular weight of 477.58 g/mol. Its IUPAC name is N-[[4-[[[(3aR,9bS)-7,8-difluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]furan-2-sulfonamide.
| Compound Name | N-[[4-[[[(3aR,9bS)-7,8-difluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 136636217 |
| Molecular Formula | C24H29F2N3O3S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-[[4-[[[(3aR,9bS)-7,8-difluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]furan-2-sulfonamide |
| SMILES | O=S(=O)(NCC1CCC(C/N=C2\C[C@H]3c4cc(F)c(F)cc4CC[C@H]3N2)CC1)c1ccco1 |
| InChI | InChI=1S/C24H29F2N3O3S/c25-20-10-17-7-8-22-19(18(17)11-21(20)26)12-23(29-22)27-13-15-3-5-16(6-4-15)14-28-33(30,31)24-2-1-9-32-24/h1-2,9-11,15-16,19,22,28H,3-8,12-14H2,(H,27,29)/t15?,16?,19-,22+/m0/s1 |
| InChIKey | OLMMAXGMYBYTGP-DUDHFMMFSA-N |
| XLogP | 4.13 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|