C28H28N4O5 — CID 136638431
(2R,3S,4R)-4-[2-[(E)-C-methyl-N-trityloxycarbonimidoyl]-1H-imidazol-5-yl]-4-nitrosobutane-1,2,3-triol (PubChem CID 136638431) has the molecular formula C28H28N4O5 and a molecular weight of 500.56 g/mol. Its IUPAC name is (2R,3S,4R)-4-[2-[(E)-C-methyl-N-trityloxycarbonimidoyl]-1H-imidazol-5-yl]-4-nitrosobutane-1,2,3-triol.
| Compound Name | (2R,3S,4R)-4-[2-[(E)-C-methyl-N-trityloxycarbonimidoyl]-1H-imidazol-5-yl]-4-nitrosobutane-1,2,3-triol |
|---|---|
| PubChem CID | 136638431 |
| Molecular Formula | C28H28N4O5 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | (2R,3S,4R)-4-[2-[(E)-C-methyl-N-trityloxycarbonimidoyl]-1H-imidazol-5-yl]-4-nitrosobutane-1,2,3-triol |
| SMILES | C/C(=N\OC(c1ccccc1)(c1ccccc1)c1ccccc1)c1ncc([C@@H](N=O)[C@H](O)[C@H](O)CO)[nH]1 |
| InChI | InChI=1S/C28H28N4O5/c1-19(27-29-17-23(30-27)25(31-36)26(35)24(34)18-33)32-37-28(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-17,24-26,33-35H,18H2,1H3,(H,29,30)/b32-19+/t24-,25-,26-/m1/s1 |
| InChIKey | AIJKWBNMUAKYAU-GCUPICFOSA-N |
| XLogP | 3.66 |
| TPSA | 140.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|