C27H30N8O9S3 — CID 136638529
2-[5-[[3-tert-butyl-1-phenyl-5-(4-sulfobutylamino)pyrazol-4-yl]diazenyl]-4-cyanopyrazol-1-yl]benzene-1,4-disulfonic acid (PubChem CID 136638529) has the molecular formula C27H30N8O9S3 and a molecular weight of 706.79 g/mol. Its IUPAC name is 2-[5-[[3-tert-butyl-1-phenyl-5-(4-sulfobutylamino)pyrazol-4-yl]diazenyl]-4-cyanopyrazol-1-yl]benzene-1,4-disulfonic acid.
| Compound Name | 2-[5-[[3-tert-butyl-1-phenyl-5-(4-sulfobutylamino)pyrazol-4-yl]diazenyl]-4-cyanopyrazol-1-yl]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 136638529 |
| Molecular Formula | C27H30N8O9S3 |
| Molecular Weight | 706.79 g/mol |
| Exact Mass | 706.13 |
| IUPAC Name | 2-[5-[[3-tert-butyl-1-phenyl-5-(4-sulfobutylamino)pyrazol-4-yl]diazenyl]-4-cyanopyrazol-1-yl]benzene-1,4-disulfonic acid |
| SMILES | CC(C)(C)c1nn(-c2ccccc2)c(NCCCCS(=O)(=O)O)c1/N=N/c1c(C#N)cnn1-c1cc(S(=O)(=O)O)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C27H30N8O9S3/c1-27(2,3)24-23(26(29-13-7-8-14-45(36,37)38)34(33-24)19-9-5-4-6-10-19)31-32-25-18(16-28)17-30-35(25)21-15-20(46(39,40)41)11-12-22(21)47(42,43)44/h4-6,9-12,15,17,29H,7-8,13-14H2,1-3H3,(H,36,37,38)(H,39,40,41)(H,42,43,44)/b32-31+ |
| InChIKey | GZDOGOKARUYDQR-QNEJGDQOSA-N |
| XLogP | 4.22 |
| TPSA | 259.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.79 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|