C23H22N8O6S2 — CID 136638534
2-[5-[(5-amino-3-tert-butyl-1-phenylpyrazol-4-yl)diazenyl]-4-cyanopyrazol-1-yl]benzene-1,4-disulfonic acid (PubChem CID 136638534) has the molecular formula C23H22N8O6S2 and a molecular weight of 570.61 g/mol. Its IUPAC name is 2-[5-[(5-amino-3-tert-butyl-1-phenylpyrazol-4-yl)diazenyl]-4-cyanopyrazol-1-yl]benzene-1,4-disulfonic acid.
| Compound Name | 2-[5-[(5-amino-3-tert-butyl-1-phenylpyrazol-4-yl)diazenyl]-4-cyanopyrazol-1-yl]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 136638534 |
| Molecular Formula | C23H22N8O6S2 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | 2-[5-[(5-amino-3-tert-butyl-1-phenylpyrazol-4-yl)diazenyl]-4-cyanopyrazol-1-yl]benzene-1,4-disulfonic acid |
| SMILES | CC(C)(C)c1nn(-c2ccccc2)c(N)c1/N=N/c1c(C#N)cnn1-c1cc(S(=O)(=O)O)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C23H22N8O6S2/c1-23(2,3)20-19(21(25)30(29-20)15-7-5-4-6-8-15)27-28-22-14(12-24)13-26-31(22)17-11-16(38(32,33)34)9-10-18(17)39(35,36)37/h4-11,13H,25H2,1-3H3,(H,32,33,34)(H,35,36,37)/b28-27+ |
| InChIKey | AQEQWVMELVIQCM-BYYHNAKLSA-N |
| XLogP | 3.72 |
| TPSA | 218.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|