C24H24N8O6S2 — CID 136638537
2-[5-[(5-amino-3-tert-butyl-1-phenylpyrazol-4-yl)diazenyl]-4-cyano-3-methylpyrazol-1-yl]benzene-1,4-disulfonic acid (PubChem CID 136638537) has the molecular formula C24H24N8O6S2 and a molecular weight of 584.64 g/mol. Its IUPAC name is 2-[5-[(5-amino-3-tert-butyl-1-phenylpyrazol-4-yl)diazenyl]-4-cyano-3-methylpyrazol-1-yl]benzene-1,4-disulfonic acid.
| Compound Name | 2-[5-[(5-amino-3-tert-butyl-1-phenylpyrazol-4-yl)diazenyl]-4-cyano-3-methylpyrazol-1-yl]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 136638537 |
| Molecular Formula | C24H24N8O6S2 |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.13 |
| IUPAC Name | 2-[5-[(5-amino-3-tert-butyl-1-phenylpyrazol-4-yl)diazenyl]-4-cyano-3-methylpyrazol-1-yl]benzene-1,4-disulfonic acid |
| SMILES | Cc1nn(-c2cc(S(=O)(=O)O)ccc2S(=O)(=O)O)c(/N=N/c2c(C(C)(C)C)nn(-c3ccccc3)c2N)c1C#N |
| InChI | InChI=1S/C24H24N8O6S2/c1-14-17(13-25)23(32(29-14)18-12-16(39(33,34)35)10-11-19(18)40(36,37)38)28-27-20-21(24(2,3)4)30-31(22(20)26)15-8-6-5-7-9-15/h5-12H,26H2,1-4H3,(H,33,34,35)(H,36,37,38)/b28-27+ |
| InChIKey | BXOMABSNEWWYQZ-BYYHNAKLSA-N |
| XLogP | 4.03 |
| TPSA | 218.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|