About 2-[1-[(3R)-piperidin-3-yl]pyrazol-4-yl]-3H-pyrido[3,4-d]pyrimidin-4-one
2-[1-[(3R)-piperidin-3-yl]pyrazol-4-yl]-3H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 136639019) has the molecular formula C15H16N6O
and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-[1-[(3R)-piperidin-3-yl]pyrazol-4-yl]-3H-pyrido[3,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-[1-[(3R)-piperidin-3-yl]pyrazol-4-yl]-3H-pyrido[3,4-d]pyrimidin-4-one |
| PubChem CID | 136639019 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-[1-[(3R)-piperidin-3-yl]pyrazol-4-yl]-3H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2cnn([C@@H]3CCCNC3)c2)nc2cnccc12 |
| InChI | InChI=1S/C15H16N6O/c22-15-12-3-5-17-8-13(12)19-14(20-15)10-6-18-21(9-10)11-2-1-4-16-7-11/h3,5-6,8-9,11,16H,1-2,4,7H2,(H,19,20,22)/t11-/m1/s1 |
| InChIKey | YLDNNDOVZCJCTN-LLVKDONJSA-N |
| XLogP | 1.11 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[1-[(3R)-piperidin-3-yl]pyrazol-4-yl]-3H-pyrido[3,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(3R)-piperidin-3-yl]pyrazol-4-yl]-3H-pyrido[3,4-d]pyrimidin-4-one?
The IUPAC name of 2-[1-[(3R)-piperidin-3-yl]pyrazol-4-yl]-3H-pyrido[3,4-d]pyrimidin-4-one (CID 136639019) is 2-[1-[(3R)-piperidin-3-yl]pyrazol-4-yl]-3H-pyrido[3,4-d]pyrimidin-4-one.
What is the SMILES notation for 2-[1-[(3R)-piperidin-3-yl]pyrazol-4-yl]-3H-pyrido[3,4-d]pyrimidin-4-one?
The canonical SMILES for 2-[1-[(3R)-piperidin-3-yl]pyrazol-4-yl]-3H-pyrido[3,4-d]pyrimidin-4-one is O=c1[nH]c(-c2cnn([C@@H]3CCCNC3)c2)nc2cnccc12.
What is the InChIKey of 2-[1-[(3R)-piperidin-3-yl]pyrazol-4-yl]-3H-pyrido[3,4-d]pyrimidin-4-one?
The InChIKey is YLDNNDOVZCJCTN-LLVKDONJSA-N. The full InChI is InChI=1S/C15H16N6O/c22-15-12-3-5-17-8-13(12)19-14(20-15)10-6-18-21(9-10)11-2-1-4-16-7-11/h3,5-6,8-9,11,16H,1-2,4,7H2,(H,19,20,22)/t11-/m1/s1.
What are the key properties of 2-[1-[(3R)-piperidin-3-yl]pyrazol-4-yl]-3H-pyrido[3,4-d]pyrimidin-4-one?
2-[1-[(3R)-piperidin-3-yl]pyrazol-4-yl]-3H-pyrido[3,4-d]pyrimidin-4-one has a molecular weight of 296.33 g/mol, XLogP of 1.11, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(3R)-piperidin-3-yl]pyrazol-4-yl]-3H-pyrido[3,4-d]pyrimidin-4-one is sourced from PubChem (CID 136639019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).