C24H22N4O3S — CID 136639510
4-ethoxy-6-[[2-(2-hydroxy-2-phenylethyl)imino-4-oxo-1,3-thiazolidin-1-ylidene]methyl]quinoline-3-carbonitrile (PubChem CID 136639510) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is 4-ethoxy-6-[[2-(2-hydroxy-2-phenylethyl)imino-4-oxo-1,3-thiazolidin-1-ylidene]methyl]quinoline-3-carbonitrile.
| Compound Name | 4-ethoxy-6-[[2-(2-hydroxy-2-phenylethyl)imino-4-oxo-1,3-thiazolidin-1-ylidene]methyl]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 136639510 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 4-ethoxy-6-[[2-(2-hydroxy-2-phenylethyl)imino-4-oxo-1,3-thiazolidin-1-ylidene]methyl]quinoline-3-carbonitrile |
| SMILES | CCOc1c(C#N)cnc2ccc(C=S3CC(=O)N/C3=N\CC(O)c3ccccc3)cc12 |
| InChI | InChI=1S/C24H22N4O3S/c1-2-31-23-18(11-25)12-26-20-9-8-16(10-19(20)23)14-32-15-22(30)28-24(32)27-13-21(29)17-6-4-3-5-7-17/h3-10,12,14,21,29H,2,13,15H2,1H3,(H,27,28,30) |
| InChIKey | QRZHJZNRPDMIOM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|