C24H25N7OS2 — CID 136639973
4-(1-ethyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepin-4-yl)-3-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 136639973) has the molecular formula C24H25N7OS2 and a molecular weight of 491.65 g/mol. Its IUPAC name is 4-(1-ethyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepin-4-yl)-3-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 4-(1-ethyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepin-4-yl)-3-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 136639973 |
| Molecular Formula | C24H25N7OS2 |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 4-(1-ethyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepin-4-yl)-3-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCn1nc(-c2ccccn2)c2c1NCCSC2c1ccc(C(=O)Nc2nnc(C)s2)cc1C |
| InChI | InChI=1S/C24H25N7OS2/c1-4-31-22-19(20(30-31)18-7-5-6-10-25-18)21(33-12-11-26-22)17-9-8-16(13-14(17)2)23(32)27-24-29-28-15(3)34-24/h5-10,13,21,26H,4,11-12H2,1-3H3,(H,27,29,32) |
| InChIKey | MGRFQYMPIGJGBY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |