C26H34N4OS — CID 136640169
4-[4-[(4S,7S)-1-ethyl-7-methyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepin-4-yl]-3-methylphenyl]-2-methylbutan-2-ol (PubChem CID 136640169) has the molecular formula C26H34N4OS and a molecular weight of 450.65 g/mol. Its IUPAC name is 4-[4-[(4S,7S)-1-ethyl-7-methyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepin-4-yl]-3-methylphenyl]-2-methylbutan-2-ol.
| Compound Name | 4-[4-[(4S,7S)-1-ethyl-7-methyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepin-4-yl]-3-methylphenyl]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 136640169 |
| Molecular Formula | C26H34N4OS |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 4-[4-[(4S,7S)-1-ethyl-7-methyl-3-pyridin-2-yl-4,6,7,8-tetrahydropyrazolo[5,4-e][1,4]thiazepin-4-yl]-3-methylphenyl]-2-methylbutan-2-ol |
| SMILES | CCn1nc(-c2ccccn2)c2c1N[C@@H](C)CS[C@H]2c1ccc(CCC(C)(C)O)cc1C |
| InChI | InChI=1S/C26H34N4OS/c1-6-30-25-22(23(29-30)21-9-7-8-14-27-21)24(32-16-18(3)28-25)20-11-10-19(15-17(20)2)12-13-26(4,5)31/h7-11,14-15,18,24,28,31H,6,12-13,16H2,1-5H3/t18-,24-/m0/s1 |
| InChIKey | JUECVSVUCFUTBS-UUOWRZLLSA-N |
| XLogP | 5.61 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |