About 2,11-diazabicyclo[5.4.0]undeca-1,7-dien-3-yne
2,11-diazabicyclo[5.4.0]undeca-1,7-dien-3-yne (PubChem CID 136640509) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 2,11-diazabicyclo[5.4.0]undeca-1,7-dien-3-yne.
Molecular Properties
| Compound Name | 2,11-diazabicyclo[5.4.0]undeca-1,7-dien-3-yne |
| PubChem CID | 136640509 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 2,11-diazabicyclo[5.4.0]undeca-1,7-dien-3-yne |
| SMILES | C1#CN=C2NCCC=C2CC1 |
| InChI | InChI=1S/C9H10N2/c1-2-6-10-9-8(4-1)5-3-7-11-9/h5H,1,3-4,7H2,(H,10,11) |
| InChIKey | RJVXHFJJAIBMFB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,11-diazabicyclo[5.4.0]undeca-1,7-dien-3-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,11-diazabicyclo[5.4.0]undeca-1,7-dien-3-yne?
The IUPAC name of 2,11-diazabicyclo[5.4.0]undeca-1,7-dien-3-yne (CID 136640509) is 2,11-diazabicyclo[5.4.0]undeca-1,7-dien-3-yne.
What is the SMILES notation for 2,11-diazabicyclo[5.4.0]undeca-1,7-dien-3-yne?
The canonical SMILES for 2,11-diazabicyclo[5.4.0]undeca-1,7-dien-3-yne is C1#CN=C2NCCC=C2CC1.
What is the InChIKey of 2,11-diazabicyclo[5.4.0]undeca-1,7-dien-3-yne?
The InChIKey is RJVXHFJJAIBMFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-2-6-10-9-8(4-1)5-3-7-11-9/h5H,1,3-4,7H2,(H,10,11).
What are the key properties of 2,11-diazabicyclo[5.4.0]undeca-1,7-dien-3-yne?
2,11-diazabicyclo[5.4.0]undeca-1,7-dien-3-yne has a molecular weight of 146.19 g/mol, XLogP of 1.06, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,11-diazabicyclo[5.4.0]undeca-1,7-dien-3-yne is sourced from PubChem (CID 136640509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).