C26H26F2N8 — CID 136640632
5-[3-[4-(2,3-difluorocyclohexa-2,4-dien-1-yl)-1,2,4-triazol-3-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-(4-methylpiperazin-1-yl)aniline (PubChem CID 136640632) has the molecular formula C26H26F2N8 and a molecular weight of 488.55 g/mol. Its IUPAC name is 5-[3-[4-(2,3-difluorocyclohexa-2,4-dien-1-yl)-1,2,4-triazol-3-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-(4-methylpiperazin-1-yl)aniline.
| Compound Name | 5-[3-[4-(2,3-difluorocyclohexa-2,4-dien-1-yl)-1,2,4-triazol-3-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-(4-methylpiperazin-1-yl)aniline |
|---|---|
| PubChem CID | 136640632 |
| Molecular Formula | C26H26F2N8 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 5-[3-[4-(2,3-difluorocyclohexa-2,4-dien-1-yl)-1,2,4-triazol-3-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-2-(4-methylpiperazin-1-yl)aniline |
| SMILES | CN1CCN(c2ccc(-c3cnc4[nH]cc(-c5nncn5C5CC=CC(F)=C5F)c4c3)cc2N)CC1 |
| InChI | InChI=1S/C26H26F2N8/c1-34-7-9-35(10-8-34)22-6-5-16(12-21(22)29)17-11-18-19(14-31-25(18)30-13-17)26-33-32-15-36(26)23-4-2-3-20(27)24(23)28/h2-3,5-6,11-15,23H,4,7-10,29H2,1H3,(H,30,31) |
| InChIKey | DNNQIMQFPQCGAK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 91.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|