About 9-amino-5-(2,4-dimethoxypyrimidin-5-yl)-2-ethyl-6-fluoropyrrolo[3,4-b]quinolin-1-ol
9-amino-5-(2,4-dimethoxypyrimidin-5-yl)-2-ethyl-6-fluoropyrrolo[3,4-b]quinolin-1-ol (PubChem CID 136641035) has the molecular formula C19H18FN5O3
and a molecular weight of 383.38 g/mol. Its IUPAC name is 9-amino-5-(2,4-dimethoxypyrimidin-5-yl)-2-ethyl-6-fluoropyrrolo[3,4-b]quinolin-1-ol.
Molecular Properties
| Compound Name | 9-amino-5-(2,4-dimethoxypyrimidin-5-yl)-2-ethyl-6-fluoropyrrolo[3,4-b]quinolin-1-ol |
| PubChem CID | 136641035 |
| Molecular Formula | C19H18FN5O3 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 9-amino-5-(2,4-dimethoxypyrimidin-5-yl)-2-ethyl-6-fluoropyrrolo[3,4-b]quinolin-1-ol |
| SMILES | CCn1cc2nc3c(-c4cnc(OC)nc4OC)c(F)ccc3c(N)c2c1O |
| InChI | InChI=1S/C19H18FN5O3/c1-4-25-8-12-14(18(25)26)15(21)9-5-6-11(20)13(16(9)23-12)10-7-22-19(28-3)24-17(10)27-2/h5-8,26H,4,21H2,1-3H3 |
| InChIKey | NBHQPRDUNSDWKP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 9-amino-5-(2,4-dimethoxypyrimidin-5-yl)-2-ethyl-6-fluoropyrrolo[3,4-b]quinolin-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-5-(2,4-dimethoxypyrimidin-5-yl)-2-ethyl-6-fluoropyrrolo[3,4-b]quinolin-1-ol?
The IUPAC name of 9-amino-5-(2,4-dimethoxypyrimidin-5-yl)-2-ethyl-6-fluoropyrrolo[3,4-b]quinolin-1-ol (CID 136641035) is 9-amino-5-(2,4-dimethoxypyrimidin-5-yl)-2-ethyl-6-fluoropyrrolo[3,4-b]quinolin-1-ol.
What is the SMILES notation for 9-amino-5-(2,4-dimethoxypyrimidin-5-yl)-2-ethyl-6-fluoropyrrolo[3,4-b]quinolin-1-ol?
The canonical SMILES for 9-amino-5-(2,4-dimethoxypyrimidin-5-yl)-2-ethyl-6-fluoropyrrolo[3,4-b]quinolin-1-ol is CCn1cc2nc3c(-c4cnc(OC)nc4OC)c(F)ccc3c(N)c2c1O.
What is the InChIKey of 9-amino-5-(2,4-dimethoxypyrimidin-5-yl)-2-ethyl-6-fluoropyrrolo[3,4-b]quinolin-1-ol?
The InChIKey is NBHQPRDUNSDWKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18FN5O3/c1-4-25-8-12-14(18(25)26)15(21)9-5-6-11(20)13(16(9)23-12)10-7-22-19(28-3)24-17(10)27-2/h5-8,26H,4,21H2,1-3H3.
What are the key properties of 9-amino-5-(2,4-dimethoxypyrimidin-5-yl)-2-ethyl-6-fluoropyrrolo[3,4-b]quinolin-1-ol?
9-amino-5-(2,4-dimethoxypyrimidin-5-yl)-2-ethyl-6-fluoropyrrolo[3,4-b]quinolin-1-ol has a molecular weight of 383.38 g/mol, XLogP of 3.11, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-5-(2,4-dimethoxypyrimidin-5-yl)-2-ethyl-6-fluoropyrrolo[3,4-b]quinolin-1-ol is sourced from PubChem (CID 136641035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).