C14H16N6O3 — CID 136641277
N'-[5-methyl-2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-3-yl]-N-prop-2-enyloxamide (PubChem CID 136641277) has the molecular formula C14H16N6O3 and a molecular weight of 316.32 g/mol. Its IUPAC name is N'-[5-methyl-2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-3-yl]-N-prop-2-enyloxamide.
| Compound Name | N'-[5-methyl-2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-3-yl]-N-prop-2-enyloxamide |
|---|---|
| PubChem CID | 136641277 |
| Molecular Formula | C14H16N6O3 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N'-[5-methyl-2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)pyrazol-3-yl]-N-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)Nc1cc(C)nn1-c1nc(C)cc(=O)[nH]1 |
| InChI | InChI=1S/C14H16N6O3/c1-4-5-15-12(22)13(23)17-10-6-9(3)19-20(10)14-16-8(2)7-11(21)18-14/h4,6-7H,1,5H2,2-3H3,(H,15,22)(H,17,23)(H,16,18,21) |
| InChIKey | ZSMGSHLASXDLKB-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|