About 4-(2-ethyl-1,2,4-triazol-3-yl)phenol
4-(2-ethyl-1,2,4-triazol-3-yl)phenol (PubChem CID 136641819) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is 4-(2-ethyl-1,2,4-triazol-3-yl)phenol.
Molecular Properties
| Compound Name | 4-(2-ethyl-1,2,4-triazol-3-yl)phenol |
| PubChem CID | 136641819 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 4-(2-ethyl-1,2,4-triazol-3-yl)phenol |
| SMILES | CCn1ncnc1-c1ccc(O)cc1 |
| InChI | InChI=1S/C10H11N3O/c1-2-13-10(11-7-12-13)8-3-5-9(14)6-4-8/h3-7,14H,2H2,1H3 |
| InChIKey | VTVHXOFYYFXBDZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-ethyl-1,2,4-triazol-3-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-ethyl-1,2,4-triazol-3-yl)phenol?
The IUPAC name of 4-(2-ethyl-1,2,4-triazol-3-yl)phenol (CID 136641819) is 4-(2-ethyl-1,2,4-triazol-3-yl)phenol.
What is the SMILES notation for 4-(2-ethyl-1,2,4-triazol-3-yl)phenol?
The canonical SMILES for 4-(2-ethyl-1,2,4-triazol-3-yl)phenol is CCn1ncnc1-c1ccc(O)cc1.
What is the InChIKey of 4-(2-ethyl-1,2,4-triazol-3-yl)phenol?
The InChIKey is VTVHXOFYYFXBDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O/c1-2-13-10(11-7-12-13)8-3-5-9(14)6-4-8/h3-7,14H,2H2,1H3.
What are the key properties of 4-(2-ethyl-1,2,4-triazol-3-yl)phenol?
4-(2-ethyl-1,2,4-triazol-3-yl)phenol has a molecular weight of 189.22 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethyl-1,2,4-triazol-3-yl)phenol is sourced from PubChem (CID 136641819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).