C25H22N2O — CID 136641834
N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(2-phenylethenyl)-1,4-dihydro-3,1-benzoxazin-2-imine (PubChem CID 136641834) has the molecular formula C25H22N2O and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(2-phenylethenyl)-1,4-dihydro-3,1-benzoxazin-2-imine.
| Compound Name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(2-phenylethenyl)-1,4-dihydro-3,1-benzoxazin-2-imine |
|---|---|
| PubChem CID | 136641834 |
| Molecular Formula | C25H22N2O |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]-6-(2-phenylethenyl)-1,4-dihydro-3,1-benzoxazin-2-imine |
| SMILES | C(=Cc1ccc2c(c1)CO/C(=N\[C@@H]1CCc3ccccc31)N2)c1ccccc1 |
| InChI | InChI=1S/C25H22N2O/c1-2-6-18(7-3-1)10-11-19-12-14-23-21(16-19)17-28-25(26-23)27-24-15-13-20-8-4-5-9-22(20)24/h1-12,14,16,24H,13,15,17H2,(H,26,27)/t24-/m1/s1 |
| InChIKey | BLAUQWXONJQKJH-XMMPIXPASA-N |
| XLogP | 5.84 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|