C56H44N8O4 — CID 136642417
2-[3-[4-[15-[4-(3-aminopropoxy)phenyl]-10,20-dipyridin-4-yl-21,23-dihydroporphyrin-5-yl]phenoxy]propyl]isoindole-1,3-dione (PubChem CID 136642417) has the molecular formula C56H44N8O4 and a molecular weight of 893.02 g/mol. Its IUPAC name is 2-[3-[4-[15-[4-(3-aminopropoxy)phenyl]-10,20-dipyridin-4-yl-21,23-dihydroporphyrin-5-yl]phenoxy]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-[15-[4-(3-aminopropoxy)phenyl]-10,20-dipyridin-4-yl-21,23-dihydroporphyrin-5-yl]phenoxy]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 136642417 |
| Molecular Formula | C56H44N8O4 |
| Molecular Weight | 893.02 g/mol |
| Exact Mass | 892.35 |
| IUPAC Name | 2-[3-[4-[15-[4-(3-aminopropoxy)phenyl]-10,20-dipyridin-4-yl-21,23-dihydroporphyrin-5-yl]phenoxy]propyl]isoindole-1,3-dione |
| SMILES | NCCCOc1ccc(-c2c3nc(c(-c4ccncc4)c4ccc([nH]4)c(-c4ccc(OCCCN5C(=O)c6ccccc6C5=O)cc4)c4nc(c(-c5ccncc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C56H44N8O4/c57-27-3-33-67-39-11-7-35(8-12-39)51-43-15-19-47(60-43)53(37-23-28-58-29-24-37)49-21-17-45(62-49)52(46-18-22-50(63-46)54(38-25-30-59-31-26-38)48-20-16-44(51)61-48)36-9-13-40(14-10-36)68-34-4-32-64-55(65)41-5-1-2-6-42(41)56(64)66/h1-2,5-26,28-31,60,63H,3-4,27,32-34,57H2/b51-43-,51-44-,52-45-,52-46-,53-47-,53-49-,54-48-,54-50- |
| InChIKey | QCJVDTBCQPRMJF-QRBRRFLASA-N |
| XLogP | 10.91 |
| TPSA | 165.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.02 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|