C38H40N6O5 — CID 136642865
tert-butyl 4-[11-(4-methoxyphenyl)-14-[(4-methoxyphenyl)methyl]-16-methyl-9-oxo-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-5-yl]piperazine-1-carboxylate (PubChem CID 136642865) has the molecular formula C38H40N6O5 and a molecular weight of 660.78 g/mol. Its IUPAC name is tert-butyl 4-[11-(4-methoxyphenyl)-14-[(4-methoxyphenyl)methyl]-16-methyl-9-oxo-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-5-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[11-(4-methoxyphenyl)-14-[(4-methoxyphenyl)methyl]-16-methyl-9-oxo-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 136642865 |
| Molecular Formula | C38H40N6O5 |
| Molecular Weight | 660.78 g/mol |
| Exact Mass | 660.31 |
| IUPAC Name | tert-butyl 4-[11-(4-methoxyphenyl)-14-[(4-methoxyphenyl)methyl]-16-methyl-9-oxo-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-5-yl]piperazine-1-carboxylate |
| SMILES | COc1ccc(Cn2nc(C)c3c4c(c(-c5ccc(OC)cc5)nc32)c(=O)[nH]c2cc(N3CCN(C(=O)OC(C)(C)C)CC3)ccc24)cc1 |
| InChI | InChI=1S/C38H40N6O5/c1-23-31-32-29-16-11-26(42-17-19-43(20-18-42)37(46)49-38(2,3)4)21-30(29)39-36(45)33(32)34(25-9-14-28(48-6)15-10-25)40-35(31)44(41-23)22-24-7-12-27(47-5)13-8-24/h7-16,21H,17-20,22H2,1-6H3,(H,39,45) |
| InChIKey | NXSSHNRSMRLBNV-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.78 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|