About N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine
N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine (PubChem CID 136643011) has the molecular formula C11H20N4O2
and a molecular weight of 240.31 g/mol. Its IUPAC name is N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine |
| PubChem CID | 136643011 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine |
| SMILES | [H]/N=C(\C)C(CCCCCC(=NO)/C(C)=N/[H])=NO |
| InChI | InChI=1S/C11H20N4O2/c1-8(12)10(14-16)6-4-3-5-7-11(15-17)9(2)13/h12-13,16-17H,3-7H2,1-2H3/b12-8+,13-9+,14-10?,15-11? |
| InChIKey | LHRQVMGVDAUQMZ-BGCAWOIWSA-N |
| XLogP | 2.68 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine?
The IUPAC name of N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine (CID 136643011) is N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine.
What is the SMILES notation for N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine?
The canonical SMILES for N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine is [H]/N=C(\C)C(CCCCCC(=NO)/C(C)=N/[H])=NO.
What is the InChIKey of N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine?
The InChIKey is LHRQVMGVDAUQMZ-BGCAWOIWSA-N. The full InChI is InChI=1S/C11H20N4O2/c1-8(12)10(14-16)6-4-3-5-7-11(15-17)9(2)13/h12-13,16-17H,3-7H2,1-2H3/b12-8+,13-9+,14-10?,15-11?.
What are the key properties of N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine?
N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine has a molecular weight of 240.31 g/mol, XLogP of 2.68, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine is sourced from PubChem (CID 136643011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).