C11H20N4O2 — CID 136643011
N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine (PubChem CID 136643011) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine.
| Compound Name | N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 136643011 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | N-(9-hydroxyimino-2,10-diiminoundecan-3-ylidene)hydroxylamine |
| SMILES | [H]/N=C(\C)C(CCCCCC(=NO)/C(C)=N/[H])=NO |
| InChI | InChI=1S/C11H20N4O2/c1-8(12)10(14-16)6-4-3-5-7-11(15-17)9(2)13/h12-13,16-17H,3-7H2,1-2H3/b12-8+,13-9+,14-10?,15-11? |
| InChIKey | LHRQVMGVDAUQMZ-BGCAWOIWSA-N |
| XLogP | 2.68 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|