C20H20IN5O2 — CID 136643669
12-[(1R,2R,4R)-2-iodo-4-[(4-methoxyphenyl)methoxy]cyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 136643669) has the molecular formula C20H20IN5O2 and a molecular weight of 489.32 g/mol. Its IUPAC name is 12-[(1R,2R,4R)-2-iodo-4-[(4-methoxyphenyl)methoxy]cyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 12-[(1R,2R,4R)-2-iodo-4-[(4-methoxyphenyl)methoxy]cyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 136643669 |
| Molecular Formula | C20H20IN5O2 |
| Molecular Weight | 489.32 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 12-[(1R,2R,4R)-2-iodo-4-[(4-methoxyphenyl)methoxy]cyclopentyl]-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | COc1ccc(CO[C@H]2C[C@@H](I)[C@@H](c3nnc4cnc5[nH]ccc5n34)C2)cc1 |
| InChI | InChI=1S/C20H20IN5O2/c1-27-13-4-2-12(3-5-13)11-28-14-8-15(16(21)9-14)20-25-24-18-10-23-19-17(26(18)20)6-7-22-19/h2-7,10,14-16,22H,8-9,11H2,1H3/t14-,15+,16-/m1/s1 |
| InChIKey | UCXLNZNCUOEQIM-OWCLPIDISA-N |
| XLogP | 3.88 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|