C17H26N6O2S — CID 136643674
N-[(1S,3R)-3-ethyl-4-[(2Z)-2-(methylidenehydrazinylidene)-5H-pyrrolo[2,3-b]pyrazin-1-yl]cyclopentyl]propane-1-sulfonamide (PubChem CID 136643674) has the molecular formula C17H26N6O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is N-[(1S,3R)-3-ethyl-4-[(2Z)-2-(methylidenehydrazinylidene)-5H-pyrrolo[2,3-b]pyrazin-1-yl]cyclopentyl]propane-1-sulfonamide.
| Compound Name | N-[(1S,3R)-3-ethyl-4-[(2Z)-2-(methylidenehydrazinylidene)-5H-pyrrolo[2,3-b]pyrazin-1-yl]cyclopentyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 136643674 |
| Molecular Formula | C17H26N6O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-[(1S,3R)-3-ethyl-4-[(2Z)-2-(methylidenehydrazinylidene)-5H-pyrrolo[2,3-b]pyrazin-1-yl]cyclopentyl]propane-1-sulfonamide |
| SMILES | C=N/N=c1/cnc2[nH]ccc2n1C1C[C@@H](NS(=O)(=O)CCC)C[C@H]1CC |
| InChI | InChI=1S/C17H26N6O2S/c1-4-8-26(24,25)22-13-9-12(5-2)15(10-13)23-14-6-7-19-17(14)20-11-16(23)21-18-3/h6-7,11-13,15,19,22H,3-5,8-10H2,1-2H3/b21-16-/t12-,13+,15?/m1/s1 |
| InChIKey | XAYHPOHXIGJXNL-UIZMJGNFSA-N |
| XLogP | 1.94 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|