C29H31N5O2 — CID 136644099
11-(4-hydroxyphenyl)-16-methyl-8-[3-(4-methylpiperazin-1-yl)propyl]-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2,4,6,10,12,15-heptaen-9-one (PubChem CID 136644099) has the molecular formula C29H31N5O2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 11-(4-hydroxyphenyl)-16-methyl-8-[3-(4-methylpiperazin-1-yl)propyl]-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2,4,6,10,12,15-heptaen-9-one.
| Compound Name | 11-(4-hydroxyphenyl)-16-methyl-8-[3-(4-methylpiperazin-1-yl)propyl]-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2,4,6,10,12,15-heptaen-9-one |
|---|---|
| PubChem CID | 136644099 |
| Molecular Formula | C29H31N5O2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 11-(4-hydroxyphenyl)-16-methyl-8-[3-(4-methylpiperazin-1-yl)propyl]-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2,4,6,10,12,15-heptaen-9-one |
| SMILES | Cc1c[nH]c2nc(-c3ccc(O)cc3)c3c(=O)n(CCCN4CCN(C)CC4)c4ccccc4c3c12 |
| InChI | InChI=1S/C29H31N5O2/c1-19-18-30-28-24(19)25-22-6-3-4-7-23(22)34(13-5-12-33-16-14-32(2)15-17-33)29(36)26(25)27(31-28)20-8-10-21(35)11-9-20/h3-4,6-11,18,35H,5,12-17H2,1-2H3,(H,30,31) |
| InChIKey | XUHHZARWUBJWFG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|