C25H23N5O2 — CID 136644100
5-[(3R)-3-aminopyrrolidin-1-yl]-11-(4-hydroxyphenyl)-16-methyl-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one (PubChem CID 136644100) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is 5-[(3R)-3-aminopyrrolidin-1-yl]-11-(4-hydroxyphenyl)-16-methyl-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one.
| Compound Name | 5-[(3R)-3-aminopyrrolidin-1-yl]-11-(4-hydroxyphenyl)-16-methyl-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one |
|---|---|
| PubChem CID | 136644100 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 5-[(3R)-3-aminopyrrolidin-1-yl]-11-(4-hydroxyphenyl)-16-methyl-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one |
| SMILES | Cc1c[nH]c2nc(-c3ccc(O)cc3)c3c(=O)[nH]c4cc(N5CC[C@@H](N)C5)ccc4c3c12 |
| InChI | InChI=1S/C25H23N5O2/c1-13-11-27-24-20(13)21-18-7-4-16(30-9-8-15(26)12-30)10-19(18)28-25(32)22(21)23(29-24)14-2-5-17(31)6-3-14/h2-7,10-11,15,31H,8-9,12,26H2,1H3,(H,27,29)(H,28,32)/t15-/m1/s1 |
| InChIKey | POTOFFQPDAYUTC-OAHLLOKOSA-N |
| XLogP | 3.78 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|