C31H34N6O2 — CID 136644103
11-(4-hydroxyphenyl)-16-methyl-5-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one (PubChem CID 136644103) has the molecular formula C31H34N6O2 and a molecular weight of 522.65 g/mol. Its IUPAC name is 11-(4-hydroxyphenyl)-16-methyl-5-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one.
| Compound Name | 11-(4-hydroxyphenyl)-16-methyl-5-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one |
|---|---|
| PubChem CID | 136644103 |
| Molecular Formula | C31H34N6O2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 11-(4-hydroxyphenyl)-16-methyl-5-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one |
| SMILES | Cc1c[nH]c2nc(-c3ccc(O)cc3)c3c(=O)[nH]c4cc(N5CCN(C6CCN(C)CC6)CC5)ccc4c3c12 |
| InChI | InChI=1S/C31H34N6O2/c1-19-18-32-30-26(19)27-24-8-5-22(37-15-13-36(14-16-37)21-9-11-35(2)12-10-21)17-25(24)33-31(39)28(27)29(34-30)20-3-6-23(38)7-4-20/h3-8,17-18,21,38H,9-16H2,1-2H3,(H,32,34)(H,33,39) |
| InChIKey | BGCUYQGAHZTCMF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|