C20H13FN4O2 — CID 136644109
11-(2-fluoro-4-hydroxyphenyl)-16-methyl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,11,13,16-heptaen-9-one (PubChem CID 136644109) has the molecular formula C20H13FN4O2 and a molecular weight of 360.35 g/mol. Its IUPAC name is 11-(2-fluoro-4-hydroxyphenyl)-16-methyl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,11,13,16-heptaen-9-one.
| Compound Name | 11-(2-fluoro-4-hydroxyphenyl)-16-methyl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,11,13,16-heptaen-9-one |
|---|---|
| PubChem CID | 136644109 |
| Molecular Formula | C20H13FN4O2 |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 11-(2-fluoro-4-hydroxyphenyl)-16-methyl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,11,13,16-heptaen-9-one |
| SMILES | Cc1[nH]nc2nc(-c3ccc(O)cc3F)c3c(=O)[nH]c4ccccc4c3c12 |
| InChI | InChI=1S/C20H13FN4O2/c1-9-15-16-12-4-2-3-5-14(12)22-20(27)17(16)18(23-19(15)25-24-9)11-7-6-10(26)8-13(11)21/h2-8,26H,1H3,(H,22,27)(H,23,24,25) |
| InChIKey | MNOIGOMBEYTMQN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|