C26H27N7O2 — CID 136644142
5-(4-aminopiperazin-1-yl)-11-(4-ethoxyphenyl)-16-methyl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,11,13,16-heptaen-9-one (PubChem CID 136644142) has the molecular formula C26H27N7O2 and a molecular weight of 469.55 g/mol. Its IUPAC name is 5-(4-aminopiperazin-1-yl)-11-(4-ethoxyphenyl)-16-methyl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,11,13,16-heptaen-9-one.
| Compound Name | 5-(4-aminopiperazin-1-yl)-11-(4-ethoxyphenyl)-16-methyl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,11,13,16-heptaen-9-one |
|---|---|
| PubChem CID | 136644142 |
| Molecular Formula | C26H27N7O2 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 5-(4-aminopiperazin-1-yl)-11-(4-ethoxyphenyl)-16-methyl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,11,13,16-heptaen-9-one |
| SMILES | CCOc1ccc(-c2nc3n[nH]c(C)c3c3c2c(=O)[nH]c2cc(N4CCN(N)CC4)ccc23)cc1 |
| InChI | InChI=1S/C26H27N7O2/c1-3-35-18-7-4-16(5-8-18)24-23-22(21-15(2)30-31-25(21)29-24)19-9-6-17(14-20(19)28-26(23)34)32-10-12-33(27)13-11-32/h4-9,14H,3,10-13,27H2,1-2H3,(H,28,34)(H,29,30,31) |
| InChIKey | BSJYPUHLBMTEKI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 116.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|