C33H35FN4O4 — CID 136644791
4-[3-(4-fluorophenyl)-2-[2-hydroxy-3-(1H-pyrrolo[2,3-c]pyridin-2-yl)phenyl]-2-piperidin-1-ylpropanoyl]piperidine-4-carboxylic acid (PubChem CID 136644791) has the molecular formula C33H35FN4O4 and a molecular weight of 570.67 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-2-[2-hydroxy-3-(1H-pyrrolo[2,3-c]pyridin-2-yl)phenyl]-2-piperidin-1-ylpropanoyl]piperidine-4-carboxylic acid.
| Compound Name | 4-[3-(4-fluorophenyl)-2-[2-hydroxy-3-(1H-pyrrolo[2,3-c]pyridin-2-yl)phenyl]-2-piperidin-1-ylpropanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 136644791 |
| Molecular Formula | C33H35FN4O4 |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-2-[2-hydroxy-3-(1H-pyrrolo[2,3-c]pyridin-2-yl)phenyl]-2-piperidin-1-ylpropanoyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)C(Cc2ccc(F)cc2)(c2cccc(-c3cc4ccncc4[nH]3)c2O)N2CCCCC2)CCNCC1 |
| InChI | InChI=1S/C33H35FN4O4/c34-24-9-7-22(8-10-24)20-33(38-17-2-1-3-18-38,30(40)32(31(41)42)12-15-35-16-13-32)26-6-4-5-25(29(26)39)27-19-23-11-14-36-21-28(23)37-27/h4-11,14,19,21,35,37,39H,1-3,12-13,15-18,20H2,(H,41,42) |
| InChIKey | DSKSISBYBRLHOL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 118.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|