C14H11FN2O2 — CID 136644818
3-(2-fluorophenyl)-5-methoxy-1H-pyrrolo[3,2-b]pyridin-2-ol (PubChem CID 136644818) has the molecular formula C14H11FN2O2 and a molecular weight of 258.25 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-5-methoxy-1H-pyrrolo[3,2-b]pyridin-2-ol.
| Compound Name | 3-(2-fluorophenyl)-5-methoxy-1H-pyrrolo[3,2-b]pyridin-2-ol |
|---|---|
| PubChem CID | 136644818 |
| Molecular Formula | C14H11FN2O2 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 3-(2-fluorophenyl)-5-methoxy-1H-pyrrolo[3,2-b]pyridin-2-ol |
| SMILES | COc1ccc2[nH]c(O)c(-c3ccccc3F)c2n1 |
| InChI | InChI=1S/C14H11FN2O2/c1-19-11-7-6-10-13(17-11)12(14(18)16-10)8-4-2-3-5-9(8)15/h2-7,16,18H,1H3 |
| InChIKey | OSAYFHKPMDZASH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |