C25H42N6O5 — CID 136645130
4-amino-7-[(2S,3S,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-methyloxolan-2-yl]-N'-hydroxypyrrolo[2,1-f][1,2,4]triazine-5-carboximidamide (PubChem CID 136645130) has the molecular formula C25H42N6O5 and a molecular weight of 506.65 g/mol. Its IUPAC name is 4-amino-7-[(2S,3S,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-methyloxolan-2-yl]-N'-hydroxypyrrolo[2,1-f][1,2,4]triazine-5-carboximidamide.
| Compound Name | 4-amino-7-[(2S,3S,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-methyloxolan-2-yl]-N'-hydroxypyrrolo[2,1-f][1,2,4]triazine-5-carboximidamide |
|---|---|
| PubChem CID | 136645130 |
| Molecular Formula | C25H42N6O5 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | 4-amino-7-[(2S,3S,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-methyloxolan-2-yl]-N'-hydroxypyrrolo[2,1-f][1,2,4]triazine-5-carboximidamide |
| SMILES | CCCCOC[C@H]1O[C@@H](c2cc(C(N)=NO)c3c(N)ncnn23)[C@](C)(OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C25H42N6O5/c1-5-8-11-33-15-19-22(34-12-9-6-2)25(4,35-13-10-7-3)21(36-19)18-14-17(23(26)30-32)20-24(27)28-16-29-31(18)20/h14,16,19,21-22,32H,5-13,15H2,1-4H3,(H2,26,30)(H2,27,28,29)/t19-,21+,22-,25+/m1/s1 |
| InChIKey | RVMJYANMOLXROA-IIOACPQZSA-N |
| XLogP | 3.42 |
| TPSA | 151.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|