C19H28N4O2 — CID 136645139
(E)-2-benzyl-3-imino-N-methyl-1,3-dimorpholin-4-ylprop-1-en-1-amine (PubChem CID 136645139) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is (E)-2-benzyl-3-imino-N-methyl-1,3-dimorpholin-4-ylprop-1-en-1-amine.
| Compound Name | (E)-2-benzyl-3-imino-N-methyl-1,3-dimorpholin-4-ylprop-1-en-1-amine |
|---|---|
| PubChem CID | 136645139 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (E)-2-benzyl-3-imino-N-methyl-1,3-dimorpholin-4-ylprop-1-en-1-amine |
| SMILES | [H]/N=C(C(/Cc1ccccc1)=C(\NC)N1CCOCC1)\N1CCOCC1 |
| InChI | InChI=1S/C19H28N4O2/c1-21-19(23-9-13-25-14-10-23)17(15-16-5-3-2-4-6-16)18(20)22-7-11-24-12-8-22/h2-6,20-21H,7-15H2,1H3/b19-17+,20-18- |
| InChIKey | LIGKLPDJVYKHRD-NADBREJJSA-N |
| XLogP | 1.30 |
| TPSA | 60.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|