C21H17N5O4 — CID 136645548
methyl N-[9-(3,4-dihydroxyphenyl)-8,13,14,16-tetrazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2,4,6,10(17),11,14-heptaen-15-yl]carbamate (PubChem CID 136645548) has the molecular formula C21H17N5O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is methyl N-[9-(3,4-dihydroxyphenyl)-8,13,14,16-tetrazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2,4,6,10(17),11,14-heptaen-15-yl]carbamate.
| Compound Name | methyl N-[9-(3,4-dihydroxyphenyl)-8,13,14,16-tetrazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2,4,6,10(17),11,14-heptaen-15-yl]carbamate |
|---|---|
| PubChem CID | 136645548 |
| Molecular Formula | C21H17N5O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | methyl N-[9-(3,4-dihydroxyphenyl)-8,13,14,16-tetrazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2,4,6,10(17),11,14-heptaen-15-yl]carbamate |
| SMILES | COC(=O)Nc1nc2c3c(ccn3n1)C(c1ccc(O)c(O)c1)Nc1ccccc1-2 |
| InChI | InChI=1S/C21H17N5O4/c1-30-21(29)24-20-23-18-12-4-2-3-5-14(12)22-17(11-6-7-15(27)16(28)10-11)13-8-9-26(25-20)19(13)18/h2-10,17,22,27-28H,1H3,(H,24,25,29) |
| InChIKey | LBQGPMDPTZFQEK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|