C20H17N5O — CID 136645686
9-(4-methoxyphenyl)-8,13,14,16-tetrazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2,4,6,10(17),11,14-heptaen-15-amine (PubChem CID 136645686) has the molecular formula C20H17N5O and a molecular weight of 343.39 g/mol. Its IUPAC name is 9-(4-methoxyphenyl)-8,13,14,16-tetrazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2,4,6,10(17),11,14-heptaen-15-amine.
| Compound Name | 9-(4-methoxyphenyl)-8,13,14,16-tetrazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2,4,6,10(17),11,14-heptaen-15-amine |
|---|---|
| PubChem CID | 136645686 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 9-(4-methoxyphenyl)-8,13,14,16-tetrazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2,4,6,10(17),11,14-heptaen-15-amine |
| SMILES | COc1ccc(C2Nc3ccccc3-c3nc(N)nn4ccc2c34)cc1 |
| InChI | InChI=1S/C20H17N5O/c1-26-13-8-6-12(7-9-13)17-15-10-11-25-19(15)18(23-20(21)24-25)14-4-2-3-5-16(14)22-17/h2-11,17,22H,1H3,(H2,21,24) |
| InChIKey | NNKWZNMPCXWOCU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 77.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |