C16H19N9 — CID 136645827
5-tert-butyl-3-[(2-methyl-6-prop-1-en-2-yl-5H-pyrazolo[1,5-b][1,2,4]triazol-7-yl)diazenyl]-1H-pyrazole-4-carbonitrile (PubChem CID 136645827) has the molecular formula C16H19N9 and a molecular weight of 337.39 g/mol. Its IUPAC name is 5-tert-butyl-3-[(2-methyl-6-prop-1-en-2-yl-5H-pyrazolo[1,5-b][1,2,4]triazol-7-yl)diazenyl]-1H-pyrazole-4-carbonitrile.
| Compound Name | 5-tert-butyl-3-[(2-methyl-6-prop-1-en-2-yl-5H-pyrazolo[1,5-b][1,2,4]triazol-7-yl)diazenyl]-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 136645827 |
| Molecular Formula | C16H19N9 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 5-tert-butyl-3-[(2-methyl-6-prop-1-en-2-yl-5H-pyrazolo[1,5-b][1,2,4]triazol-7-yl)diazenyl]-1H-pyrazole-4-carbonitrile |
| SMILES | C=C(C)c1[nH]n2nc(C)nc2c1/N=N/c1n[nH]c(C(C)(C)C)c1C#N |
| InChI | InChI=1S/C16H19N9/c1-8(2)11-12(15-18-9(3)23-25(15)24-11)19-21-14-10(7-17)13(20-22-14)16(4,5)6/h24H,1H2,2-6H3,(H,20,22)/b21-19+ |
| InChIKey | UIUVMOSIZSXGTN-XUTLUUPISA-N |
| XLogP | 3.71 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|