C10H9ClN6O2 — CID 136646092
2-(4-amino-1,2,5-oxadiazol-3-yl)-4-chloro-6-ethyl-1H-imidazo[4,5-c]pyridin-7-ol (PubChem CID 136646092) has the molecular formula C10H9ClN6O2 and a molecular weight of 280.68 g/mol. Its IUPAC name is 2-(4-amino-1,2,5-oxadiazol-3-yl)-4-chloro-6-ethyl-1H-imidazo[4,5-c]pyridin-7-ol.
| Compound Name | 2-(4-amino-1,2,5-oxadiazol-3-yl)-4-chloro-6-ethyl-1H-imidazo[4,5-c]pyridin-7-ol |
|---|---|
| PubChem CID | 136646092 |
| Molecular Formula | C10H9ClN6O2 |
| Molecular Weight | 280.68 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2-(4-amino-1,2,5-oxadiazol-3-yl)-4-chloro-6-ethyl-1H-imidazo[4,5-c]pyridin-7-ol |
| SMILES | CCc1nc(Cl)c2nc(-c3nonc3N)[nH]c2c1O |
| InChI | InChI=1S/C10H9ClN6O2/c1-2-3-7(18)4-5(8(11)13-3)15-10(14-4)6-9(12)17-19-16-6/h18H,2H2,1H3,(H2,12,17)(H,14,15) |
| InChIKey | RMQRFKQUGYBLNI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.68 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|