About 5,7-dimethyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine
5,7-dimethyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine (PubChem CID 136646385) has the molecular formula C6H9N5
and a molecular weight of 151.17 g/mol. Its IUPAC name is 5,7-dimethyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine.
Analyze 5,7-dimethyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine?
The IUPAC name of 5,7-dimethyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine (CID 136646385) is 5,7-dimethyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 5,7-dimethyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine?
The canonical SMILES for 5,7-dimethyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine is CC1=CC(C)n2nnnc2N1.
What is the InChIKey of 5,7-dimethyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine?
The InChIKey is OWWXZNCGJQOBQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N5/c1-4-3-5(2)11-6(7-4)8-9-10-11/h3,5H,1-2H3,(H,7,8,10).
What are the key properties of 5,7-dimethyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine?
5,7-dimethyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine has a molecular weight of 151.17 g/mol, XLogP of 0.56, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 136646385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).