About 5-ethyl-N,5-dimethyl-1,3-diazinan-2-imine
5-ethyl-N,5-dimethyl-1,3-diazinan-2-imine (PubChem CID 136646704) has the molecular formula C8H17N3
and a molecular weight of 155.25 g/mol. Its IUPAC name is 5-ethyl-N,5-dimethyl-1,3-diazinan-2-imine.
Molecular Properties
| Compound Name | 5-ethyl-N,5-dimethyl-1,3-diazinan-2-imine |
| PubChem CID | 136646704 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 5-ethyl-N,5-dimethyl-1,3-diazinan-2-imine |
| SMILES | CCC1(C)CNC(=NC)NC1 |
| InChI | InChI=1S/C8H17N3/c1-4-8(2)5-10-7(9-3)11-6-8/h4-6H2,1-3H3,(H2,9,10,11) |
| InChIKey | VIUDSCVDSSJSCM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-N,5-dimethyl-1,3-diazinan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-N,5-dimethyl-1,3-diazinan-2-imine?
The IUPAC name of 5-ethyl-N,5-dimethyl-1,3-diazinan-2-imine (CID 136646704) is 5-ethyl-N,5-dimethyl-1,3-diazinan-2-imine.
What is the SMILES notation for 5-ethyl-N,5-dimethyl-1,3-diazinan-2-imine?
The canonical SMILES for 5-ethyl-N,5-dimethyl-1,3-diazinan-2-imine is CCC1(C)CNC(=NC)NC1.
What is the InChIKey of 5-ethyl-N,5-dimethyl-1,3-diazinan-2-imine?
The InChIKey is VIUDSCVDSSJSCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3/c1-4-8(2)5-10-7(9-3)11-6-8/h4-6H2,1-3H3,(H2,9,10,11).
What are the key properties of 5-ethyl-N,5-dimethyl-1,3-diazinan-2-imine?
5-ethyl-N,5-dimethyl-1,3-diazinan-2-imine has a molecular weight of 155.25 g/mol, XLogP of 0.58, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-N,5-dimethyl-1,3-diazinan-2-imine is sourced from PubChem (CID 136646704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).