C18H22N4O3 — CID 136646788
N-(2-ethenylbut-3-enyl)-2-[3-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]acetamide (PubChem CID 136646788) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-(2-ethenylbut-3-enyl)-2-[3-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]acetamide.
| Compound Name | N-(2-ethenylbut-3-enyl)-2-[3-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]acetamide |
|---|---|
| PubChem CID | 136646788 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-(2-ethenylbut-3-enyl)-2-[3-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]acetamide |
| SMILES | C=CC(C=C)CNC(=O)CC1CC(c2ccc(/C(N)=N\O)cc2)=NO1 |
| InChI | InChI=1S/C18H22N4O3/c1-3-12(4-2)11-20-17(23)10-15-9-16(22-25-15)13-5-7-14(8-6-13)18(19)21-24/h3-8,12,15,24H,1-2,9-11H2,(H2,19,21)(H,20,23) |
| InChIKey | ZTESMYDGEDJGSM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|