About 5-methylsulfanyl-6,7-dihydro-1H-pyrazolo[5,4-b]pyridine
5-methylsulfanyl-6,7-dihydro-1H-pyrazolo[5,4-b]pyridine (PubChem CID 136647724) has the molecular formula C7H9N3S
and a molecular weight of 167.24 g/mol. Its IUPAC name is 5-methylsulfanyl-6,7-dihydro-1H-pyrazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 5-methylsulfanyl-6,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
| PubChem CID | 136647724 |
| Molecular Formula | C7H9N3S |
| Molecular Weight | 167.24 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 5-methylsulfanyl-6,7-dihydro-1H-pyrazolo[5,4-b]pyridine |
| SMILES | CSC1=Cc2cn[nH]c2NC1 |
| InChI | InChI=1S/C7H9N3S/c1-11-6-2-5-3-9-10-7(5)8-4-6/h2-3H,4H2,1H3,(H2,8,9,10) |
| InChIKey | HMZKNWQSGZGTMA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methylsulfanyl-6,7-dihydro-1H-pyrazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfanyl-6,7-dihydro-1H-pyrazolo[5,4-b]pyridine?
The IUPAC name of 5-methylsulfanyl-6,7-dihydro-1H-pyrazolo[5,4-b]pyridine (CID 136647724) is 5-methylsulfanyl-6,7-dihydro-1H-pyrazolo[5,4-b]pyridine.
What is the SMILES notation for 5-methylsulfanyl-6,7-dihydro-1H-pyrazolo[5,4-b]pyridine?
The canonical SMILES for 5-methylsulfanyl-6,7-dihydro-1H-pyrazolo[5,4-b]pyridine is CSC1=Cc2cn[nH]c2NC1.
What is the InChIKey of 5-methylsulfanyl-6,7-dihydro-1H-pyrazolo[5,4-b]pyridine?
The InChIKey is HMZKNWQSGZGTMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3S/c1-11-6-2-5-3-9-10-7(5)8-4-6/h2-3H,4H2,1H3,(H2,8,9,10).
What are the key properties of 5-methylsulfanyl-6,7-dihydro-1H-pyrazolo[5,4-b]pyridine?
5-methylsulfanyl-6,7-dihydro-1H-pyrazolo[5,4-b]pyridine has a molecular weight of 167.24 g/mol, XLogP of 1.54, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfanyl-6,7-dihydro-1H-pyrazolo[5,4-b]pyridine is sourced from PubChem (CID 136647724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).