C34H44N4O6 — CID 136647954
cyclohex-3-en-1-ylmethyl 7-[[5-(diethylamino)-3-hydroxy-1-oxo-3a,4,5,6,7,7a-hexahydroinden-2-yl]diazenyl]-1,3-dioxo-2-pentan-3-ylisoindole-4-carboxylate (PubChem CID 136647954) has the molecular formula C34H44N4O6 and a molecular weight of 604.75 g/mol. Its IUPAC name is cyclohex-3-en-1-ylmethyl 7-[[5-(diethylamino)-3-hydroxy-1-oxo-3a,4,5,6,7,7a-hexahydroinden-2-yl]diazenyl]-1,3-dioxo-2-pentan-3-ylisoindole-4-carboxylate.
| Compound Name | cyclohex-3-en-1-ylmethyl 7-[[5-(diethylamino)-3-hydroxy-1-oxo-3a,4,5,6,7,7a-hexahydroinden-2-yl]diazenyl]-1,3-dioxo-2-pentan-3-ylisoindole-4-carboxylate |
|---|---|
| PubChem CID | 136647954 |
| Molecular Formula | C34H44N4O6 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.33 |
| IUPAC Name | cyclohex-3-en-1-ylmethyl 7-[[5-(diethylamino)-3-hydroxy-1-oxo-3a,4,5,6,7,7a-hexahydroinden-2-yl]diazenyl]-1,3-dioxo-2-pentan-3-ylisoindole-4-carboxylate |
| SMILES | CCC(CC)N1C(=O)c2c(/N=N/C3=C(O)C4CC(N(CC)CC)CCC4C3=O)ccc(C(=O)OCC3CC=CCC3)c2C1=O |
| InChI | InChI=1S/C34H44N4O6/c1-5-21(6-2)38-32(41)27-24(34(43)44-19-20-12-10-9-11-13-20)16-17-26(28(27)33(38)42)35-36-29-30(39)23-15-14-22(37(7-3)8-4)18-25(23)31(29)40/h9-10,16-17,20-23,25,40H,5-8,11-15,18-19H2,1-4H3/b36-35+ |
| InChIKey | SCVHWVBHXMGKRZ-ULDVOPSXSA-N |
| XLogP | 6.55 |
| TPSA | 128.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|