C6H7N5O2 — CID 136648281
2-amino-3,4a,5,7-tetrahydropteridine-4,6-dione (PubChem CID 136648281) has the molecular formula C6H7N5O2 and a molecular weight of 181.16 g/mol. Its IUPAC name is 2-amino-3,4a,5,7-tetrahydropteridine-4,6-dione.
| Compound Name | 2-amino-3,4a,5,7-tetrahydropteridine-4,6-dione |
|---|---|
| PubChem CID | 136648281 |
| Molecular Formula | C6H7N5O2 |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 2-amino-3,4a,5,7-tetrahydropteridine-4,6-dione |
| SMILES | NC1=NC2=NCC(=O)NC2C(=O)N1 |
| InChI | InChI=1S/C6H7N5O2/c7-6-10-4-3(5(13)11-6)9-2(12)1-8-4/h3H,1H2,(H,9,12)(H3,7,8,10,11,13) |
| InChIKey | WBZKQFAVPDYTLF-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |