C33H33N9O11 — CID 136648455
4,6-bis[4-[[3,5-bis(hydroperoxymethyl)phenyl]diazenyl]-2-methoxyanilino]-1H-1,3,5-triazin-2-one (PubChem CID 136648455) has the molecular formula C33H33N9O11 and a molecular weight of 731.68 g/mol. Its IUPAC name is 4,6-bis[4-[[3,5-bis(hydroperoxymethyl)phenyl]diazenyl]-2-methoxyanilino]-1H-1,3,5-triazin-2-one.
| Compound Name | 4,6-bis[4-[[3,5-bis(hydroperoxymethyl)phenyl]diazenyl]-2-methoxyanilino]-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 136648455 |
| Molecular Formula | C33H33N9O11 |
| Molecular Weight | 731.68 g/mol |
| Exact Mass | 731.23 |
| IUPAC Name | 4,6-bis[4-[[3,5-bis(hydroperoxymethyl)phenyl]diazenyl]-2-methoxyanilino]-1H-1,3,5-triazin-2-one |
| SMILES | COc1cc(/N=N/c2cc(COO)cc(COO)c2)ccc1Nc1nc(Nc2ccc(/N=N/c3cc(COO)cc(COO)c3)cc2OC)[nH]c(=O)n1 |
| InChI | InChI=1S/C33H33N9O11/c1-48-29-13-23(39-41-25-9-19(15-50-44)7-20(10-25)16-51-45)3-5-27(29)34-31-36-32(38-33(43)37-31)35-28-6-4-24(14-30(28)49-2)40-42-26-11-21(17-52-46)8-22(12-26)18-53-47/h3-14,44-47H,15-18H2,1-2H3,(H3,34,35,36,37,38,43)/b41-39+,42-40+ |
| InChIKey | OTGPOCRFCWWGBD-LMXNTIJMSA-N |
| XLogP | 7.46 |
| TPSA | 268.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.68 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|