C22H31N5O7S4 — CID 136648704
3-[5-[2-(3,4-diethyl-5-methylpyrrolo[2,3-d]imidazol-2-yl)ethenyl]-2-oxo-6-sulfanyl-4-sulfanylidene-3-(3-sulfopropyl)pyrimidin-1-yl]propane-1-sulfonic acid (PubChem CID 136648704) has the molecular formula C22H31N5O7S4 and a molecular weight of 605.79 g/mol. Its IUPAC name is 3-[5-[2-(3,4-diethyl-5-methylpyrrolo[2,3-d]imidazol-2-yl)ethenyl]-2-oxo-6-sulfanyl-4-sulfanylidene-3-(3-sulfopropyl)pyrimidin-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[5-[2-(3,4-diethyl-5-methylpyrrolo[2,3-d]imidazol-2-yl)ethenyl]-2-oxo-6-sulfanyl-4-sulfanylidene-3-(3-sulfopropyl)pyrimidin-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 136648704 |
| Molecular Formula | C22H31N5O7S4 |
| Molecular Weight | 605.79 g/mol |
| Exact Mass | 605.11 |
| IUPAC Name | 3-[5-[2-(3,4-diethyl-5-methylpyrrolo[2,3-d]imidazol-2-yl)ethenyl]-2-oxo-6-sulfanyl-4-sulfanylidene-3-(3-sulfopropyl)pyrimidin-1-yl]propane-1-sulfonic acid |
| SMILES | CCn1c(C)cc2nc(C=Cc3c(S)n(CCCS(=O)(=O)O)c(=O)n(CCCS(=O)(=O)O)c3=S)n(CC)c21 |
| InChI | InChI=1S/C22H31N5O7S4/c1-4-24-15(3)14-17-19(24)25(5-2)18(23-17)9-8-16-20(35)26(10-6-12-37(29,30)31)22(28)27(21(16)36)11-7-13-38(32,33)34/h8-9,14,35H,4-7,10-13H2,1-3H3,(H,29,30,31)(H,32,33,34) |
| InChIKey | FBXXSZYQHNBKOY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 158.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.79 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|