C31H35ClN2O8 — CID 136648836
6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]oxane-2,4-dione (PubChem CID 136648836) has the molecular formula C31H35ClN2O8 and a molecular weight of 599.08 g/mol. Its IUPAC name is 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]oxane-2,4-dione.
| Compound Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 136648836 |
| Molecular Formula | C31H35ClN2O8 |
| Molecular Weight | 599.08 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]oxane-2,4-dione |
| SMILES | COc1cc(OC)c(CCC2(C3CCCC3)CC(=O)C(Cc3nc4cc(OC)c(OC)cc4c(=O)[nH]3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C31H35ClN2O8/c1-38-24-15-25(39-2)21(32)11-17(24)9-10-31(18-7-5-6-8-18)16-23(35)20(30(37)42-31)13-28-33-22-14-27(41-4)26(40-3)12-19(22)29(36)34-28/h11-12,14-15,18,20H,5-10,13,16H2,1-4H3,(H,33,34,36) |
| InChIKey | JVBRNUMTIDEZHE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.08 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|