C10H10Cl3NO — CID 136648944
2,4-dichloro-6-[N-(2-chloroethyl)-C-methylcarbonimidoyl]phenol (PubChem CID 136648944) has the molecular formula C10H10Cl3NO and a molecular weight of 266.56 g/mol. Its IUPAC name is 2,4-dichloro-6-[N-(2-chloroethyl)-C-methylcarbonimidoyl]phenol.
| Compound Name | 2,4-dichloro-6-[N-(2-chloroethyl)-C-methylcarbonimidoyl]phenol |
|---|---|
| PubChem CID | 136648944 |
| Molecular Formula | C10H10Cl3NO |
| Molecular Weight | 266.56 g/mol |
| Exact Mass | 264.98 |
| IUPAC Name | 2,4-dichloro-6-[N-(2-chloroethyl)-C-methylcarbonimidoyl]phenol |
| SMILES | C/C(=N\CCCl)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C10H10Cl3NO/c1-6(14-3-2-11)8-4-7(12)5-9(13)10(8)15/h4-5,15H,2-3H2,1H3/b14-6+ |
| InChIKey | PDDUCBNMTKNBOV-MKMNVTDBSA-N |
| XLogP | 3.75 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|